| Name | Cyclopentanecarbonyl chloride |
| Synonyms | Cyclopetanecarbonylchloride (Chlorocarbonyl)cyclopentane Cyclopenanecarbonyl chloride Cyclopentanecarbonylchloride CYCLOPENTANECARBONYL CHLORIDE Cyclopentanecarbonyl chloride Cyclopentane carboxyl chloride CYCLOPENTANECARBOXYLIC ACID CHLORIDE CYCLOPENTANECARBOXYLIC ACID CHLORIDE |
| CAS | 4524-93-0 |
| EINECS | 224-856-1 |
| InChI | InChI=1/C6H9ClO/c7-6(8)5-3-1-2-4-5/h5H,1-4H2 |
| Molecular Formula | C6H9ClO |
| Molar Mass | 132.59 |
| Density | 1.091g/mLat 25°C(lit.) |
| Boling Point | 161-162°C(lit.) |
| Flash Point | 140°F |
| Water Solubility | Reacts with water. |
| Vapor Presure | 2.27mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.091 |
| Color | Clear colorless to yellow |
| BRN | 1237147 |
| Sensitive | Moisture Sensitive |
| Refractive Index | n20/D 1.4622(lit.) |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 29162000 |
| Hazard Class | 8 |
| Packing Group | II |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |